C24H29N3O3S — CID 57053955
[3-(5-cyclohexyl-1,3,4-oxadiazol-2-yl)-2-methyl-1,2-benzothiazin-4-yl] cyclohexanecarboxylate (PubChem CID 57053955) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is [3-(5-cyclohexyl-1,3,4-oxadiazol-2-yl)-2-methyl-1,2-benzothiazin-4-yl] cyclohexanecarboxylate.
| Compound Name | [3-(5-cyclohexyl-1,3,4-oxadiazol-2-yl)-2-methyl-1,2-benzothiazin-4-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 57053955 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | [3-(5-cyclohexyl-1,3,4-oxadiazol-2-yl)-2-methyl-1,2-benzothiazin-4-yl] cyclohexanecarboxylate |
| SMILES | CN1Sc2ccccc2C(OC(=O)C2CCCCC2)=C1c1nnc(C2CCCCC2)o1 |
| InChI | InChI=1S/C24H29N3O3S/c1-27-20(23-26-25-22(30-23)16-10-4-2-5-11-16)21(18-14-8-9-15-19(18)31-27)29-24(28)17-12-6-3-7-13-17/h8-9,14-17H,2-7,10-13H2,1H3 |
| InChIKey | IJSWADREESINBR-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|