C22H23NO4S — CID 57054254
ethyl 1-[(2S)-3-benzoylsulfanyl-2-methylpropanoyl]-2,3-dihydroindole-2-carboxylate (PubChem CID 57054254) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is ethyl 1-[(2S)-3-benzoylsulfanyl-2-methylpropanoyl]-2,3-dihydroindole-2-carboxylate.
| Compound Name | ethyl 1-[(2S)-3-benzoylsulfanyl-2-methylpropanoyl]-2,3-dihydroindole-2-carboxylate |
|---|---|
| PubChem CID | 57054254 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | ethyl 1-[(2S)-3-benzoylsulfanyl-2-methylpropanoyl]-2,3-dihydroindole-2-carboxylate |
| SMILES | CCOC(=O)C1Cc2ccccc2N1C(=O)[C@H](C)CSC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H23NO4S/c1-3-27-21(25)19-13-17-11-7-8-12-18(17)23(19)20(24)15(2)14-28-22(26)16-9-5-4-6-10-16/h4-12,15,19H,3,13-14H2,1-2H3/t15-,19?/m1/s1 |
| InChIKey | OPEOMXXMGWBRHM-NYRJJRHWSA-N |
| XLogP | 3.72 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|