About 2-methylindol-2-ylium
2-methylindol-2-ylium (PubChem CID 57054412) has the molecular formula C9H8N+
and a molecular weight of 130.17 g/mol. Its IUPAC name is 2-methylindol-2-ylium.
Molecular Properties
| Compound Name | 2-methylindol-2-ylium |
| PubChem CID | 57054412 |
| Molecular Formula | C9H8N+ |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.07 |
| IUPAC Name | 2-methylindol-2-ylium |
| SMILES | C[C+]1C=c2ccccc2=N1 |
| InChI | InChI=1S/C9H8N/c1-7-6-8-4-2-3-5-9(8)10-7/h2-6H,1H3/q+1 |
| InChIKey | YARTYHKUXZCOKM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methylindol-2-ylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylindol-2-ylium?
The IUPAC name of 2-methylindol-2-ylium (CID 57054412) is 2-methylindol-2-ylium.
What is the SMILES notation for 2-methylindol-2-ylium?
The canonical SMILES for 2-methylindol-2-ylium is C[C+]1C=c2ccccc2=N1.
What is the InChIKey of 2-methylindol-2-ylium?
The InChIKey is YARTYHKUXZCOKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N/c1-7-6-8-4-2-3-5-9(8)10-7/h2-6H,1H3/q+1.
What are the key properties of 2-methylindol-2-ylium?
2-methylindol-2-ylium has a molecular weight of 130.17 g/mol, XLogP of 0.65, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylindol-2-ylium is sourced from PubChem (CID 57054412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).