About 2-[2,4-bis(4-methylphenyl)phenyl]ethanimine
2-[2,4-bis(4-methylphenyl)phenyl]ethanimine (PubChem CID 57054475) has the molecular formula C22H21N
and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-[2,4-bis(4-methylphenyl)phenyl]ethanimine.
Molecular Properties
| Compound Name | 2-[2,4-bis(4-methylphenyl)phenyl]ethanimine |
| PubChem CID | 57054475 |
| Molecular Formula | C22H21N |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 2-[2,4-bis(4-methylphenyl)phenyl]ethanimine |
| SMILES | [H]/N=C/Cc1ccc(-c2ccc(C)cc2)cc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C22H21N/c1-16-3-7-18(8-4-16)21-12-11-20(13-14-23)22(15-21)19-9-5-17(2)6-10-19/h3-12,14-15,23H,13H2,1-2H3/b23-14+ |
| InChIKey | QMVVGWBBVORYTK-OEAKJJBVSA-N |
| XLogP | 5.83 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,4-bis(4-methylphenyl)phenyl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,4-bis(4-methylphenyl)phenyl]ethanimine?
The IUPAC name of 2-[2,4-bis(4-methylphenyl)phenyl]ethanimine (CID 57054475) is 2-[2,4-bis(4-methylphenyl)phenyl]ethanimine.
What is the SMILES notation for 2-[2,4-bis(4-methylphenyl)phenyl]ethanimine?
The canonical SMILES for 2-[2,4-bis(4-methylphenyl)phenyl]ethanimine is [H]/N=C/Cc1ccc(-c2ccc(C)cc2)cc1-c1ccc(C)cc1.
What is the InChIKey of 2-[2,4-bis(4-methylphenyl)phenyl]ethanimine?
The InChIKey is QMVVGWBBVORYTK-OEAKJJBVSA-N. The full InChI is InChI=1S/C22H21N/c1-16-3-7-18(8-4-16)21-12-11-20(13-14-23)22(15-21)19-9-5-17(2)6-10-19/h3-12,14-15,23H,13H2,1-2H3/b23-14+.
What are the key properties of 2-[2,4-bis(4-methylphenyl)phenyl]ethanimine?
2-[2,4-bis(4-methylphenyl)phenyl]ethanimine has a molecular weight of 299.42 g/mol, XLogP of 5.83, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,4-bis(4-methylphenyl)phenyl]ethanimine is sourced from PubChem (CID 57054475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).