C9H9NO3 — CID 57054508
4a,5,6,8a-tetrahydro-1H-quinoline-2,3,4-trione (PubChem CID 57054508) has the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. Its IUPAC name is 4a,5,6,8a-tetrahydro-1H-quinoline-2,3,4-trione.
| Compound Name | 4a,5,6,8a-tetrahydro-1H-quinoline-2,3,4-trione |
|---|---|
| PubChem CID | 57054508 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 4a,5,6,8a-tetrahydro-1H-quinoline-2,3,4-trione |
| SMILES | O=C1NC2C=CCCC2C(=O)C1=O |
| InChI | InChI=1S/C9H9NO3/c11-7-5-3-1-2-4-6(5)10-9(13)8(7)12/h2,4-6H,1,3H2,(H,10,13) |
| InChIKey | LFCPBQTUCJOGQV-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|