C11H11NOS — CID 57054662
2-(benzenesulfinyl)-3,4-dihydropyridine (PubChem CID 57054662) has the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. Its IUPAC name is 2-(benzenesulfinyl)-3,4-dihydropyridine.
| Compound Name | 2-(benzenesulfinyl)-3,4-dihydropyridine |
|---|---|
| PubChem CID | 57054662 |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 2-(benzenesulfinyl)-3,4-dihydropyridine |
| SMILES | O=S(C1=NC=CCC1)c1ccccc1 |
| InChI | InChI=1S/C11H11NOS/c13-14(10-6-2-1-3-7-10)11-8-4-5-9-12-11/h1-3,5-7,9H,4,8H2 |
| InChIKey | QPAHLZXRBUBMMB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |