C24H42O5 — CID 57054765
propan-2-yl 7-[(2R,3R,5S)-5-hydroxy-2-(8-hydroxyoct-1-enyl)-3-methoxycyclopentyl]hept-2-enoate (PubChem CID 57054765) has the molecular formula C24H42O5 and a molecular weight of 410.60 g/mol. Its IUPAC name is propan-2-yl 7-[(2R,3R,5S)-5-hydroxy-2-(8-hydroxyoct-1-enyl)-3-methoxycyclopentyl]hept-2-enoate.
| Compound Name | propan-2-yl 7-[(2R,3R,5S)-5-hydroxy-2-(8-hydroxyoct-1-enyl)-3-methoxycyclopentyl]hept-2-enoate |
|---|---|
| PubChem CID | 57054765 |
| Molecular Formula | C24H42O5 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | propan-2-yl 7-[(2R,3R,5S)-5-hydroxy-2-(8-hydroxyoct-1-enyl)-3-methoxycyclopentyl]hept-2-enoate |
| SMILES | CO[C@@H]1C[C@H](O)C(CCCCC=CC(=O)OC(C)C)[C@H]1C=CCCCCCCO |
| InChI | InChI=1S/C24H42O5/c1-19(2)29-24(27)16-12-8-7-10-14-20-21(23(28-3)18-22(20)26)15-11-6-4-5-9-13-17-25/h11-12,15-16,19-23,25-26H,4-10,13-14,17-18H2,1-3H3/t20?,21-,22+,23-/m1/s1 |
| InChIKey | FPRAEJIEQHKNEL-WVUPVLJSSA-N |
| XLogP | 4.57 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|