C31H60O2Si2 — CID 57055496
[(1R,4S)-4-[(2R)-2-[(1R,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propyl]-1-methylcyclopent-2-en-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 57055496) has the molecular formula C31H60O2Si2 and a molecular weight of 520.99 g/mol. Its IUPAC name is [(1R,4S)-4-[(2R)-2-[(1R,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propyl]-1-methylcyclopent-2-en-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,4S)-4-[(2R)-2-[(1R,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propyl]-1-methylcyclopent-2-en-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 57055496 |
| Molecular Formula | C31H60O2Si2 |
| Molecular Weight | 520.99 g/mol |
| Exact Mass | 520.41 |
| IUPAC Name | [(1R,4S)-4-[(2R)-2-[(1R,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propyl]-1-methylcyclopent-2-en-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@H](C[C@@H]1C=C[C@](C)(O[Si](C)(C)C(C)(C)C)C1)[C@H]1CCC2C(O[Si](C)(C)C(C)(C)C)CCC[C@@]21C |
| InChI | InChI=1S/C31H60O2Si2/c1-23(21-24-18-20-30(8,22-24)33-35(12,13)29(5,6)7)25-16-17-26-27(15-14-19-31(25,26)9)32-34(10,11)28(2,3)4/h18,20,23-27H,14-17,19,21-22H2,1-13H3/t23-,24+,25-,26?,27?,30+,31-/m1/s1 |
| InChIKey | CMFZNHIPFJFKQI-UYRQKZGVSA-N |
| XLogP | 9.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.99 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|