C13H20N2 — CID 57055610
N-methyl-N-propyl-6,7,8,8a-tetrahydroquinolin-7-amine (PubChem CID 57055610) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is N-methyl-N-propyl-6,7,8,8a-tetrahydroquinolin-7-amine.
| Compound Name | N-methyl-N-propyl-6,7,8,8a-tetrahydroquinolin-7-amine |
|---|---|
| PubChem CID | 57055610 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N-methyl-N-propyl-6,7,8,8a-tetrahydroquinolin-7-amine |
| SMILES | CCCN(C)C1CC=C2C=CC=NC2C1 |
| InChI | InChI=1S/C13H20N2/c1-3-9-15(2)12-7-6-11-5-4-8-14-13(11)10-12/h4-6,8,12-13H,3,7,9-10H2,1-2H3 |
| InChIKey | QQSROHYNFUWLKL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |