About 4-(chloromethyl)-3-thia-4-azatricyclo[5.2.1.02,6]dec-2(6)-en-5-one
4-(chloromethyl)-3-thia-4-azatricyclo[5.2.1.02,6]dec-2(6)-en-5-one (PubChem CID 57056167) has the molecular formula C9H10ClNOS
and a molecular weight of 215.70 g/mol. Its IUPAC name is 4-(chloromethyl)-3-thia-4-azatricyclo[5.2.1.02,6]dec-2(6)-en-5-one.
Molecular Properties
| Compound Name | 4-(chloromethyl)-3-thia-4-azatricyclo[5.2.1.02,6]dec-2(6)-en-5-one |
| PubChem CID | 57056167 |
| Molecular Formula | C9H10ClNOS |
| Molecular Weight | 215.70 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | 4-(chloromethyl)-3-thia-4-azatricyclo[5.2.1.02,6]dec-2(6)-en-5-one |
| SMILES | O=c1c2c(sn1CCl)C1CCC2C1 |
| InChI | InChI=1S/C9H10ClNOS/c10-4-11-9(12)7-5-1-2-6(3-5)8(7)13-11/h5-6H,1-4H2 |
| InChIKey | RWWKKSVRKQWBEH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.70 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)-3-thia-4-azatricyclo[5.2.1.02,6]dec-2(6)-en-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)-3-thia-4-azatricyclo[5.2.1.02,6]dec-2(6)-en-5-one?
The IUPAC name of 4-(chloromethyl)-3-thia-4-azatricyclo[5.2.1.02,6]dec-2(6)-en-5-one (CID 57056167) is 4-(chloromethyl)-3-thia-4-azatricyclo[5.2.1.02,6]dec-2(6)-en-5-one.
What is the SMILES notation for 4-(chloromethyl)-3-thia-4-azatricyclo[5.2.1.02,6]dec-2(6)-en-5-one?
The canonical SMILES for 4-(chloromethyl)-3-thia-4-azatricyclo[5.2.1.02,6]dec-2(6)-en-5-one is O=c1c2c(sn1CCl)C1CCC2C1.
What is the InChIKey of 4-(chloromethyl)-3-thia-4-azatricyclo[5.2.1.02,6]dec-2(6)-en-5-one?
The InChIKey is RWWKKSVRKQWBEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNOS/c10-4-11-9(12)7-5-1-2-6(3-5)8(7)13-11/h5-6H,1-4H2.
What are the key properties of 4-(chloromethyl)-3-thia-4-azatricyclo[5.2.1.02,6]dec-2(6)-en-5-one?
4-(chloromethyl)-3-thia-4-azatricyclo[5.2.1.02,6]dec-2(6)-en-5-one has a molecular weight of 215.70 g/mol, XLogP of 2.47, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)-3-thia-4-azatricyclo[5.2.1.02,6]dec-2(6)-en-5-one is sourced from PubChem (CID 57056167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).