About 3-ethenoxyfuran-2,5-dione
3-ethenoxyfuran-2,5-dione (PubChem CID 57056226) has the molecular formula C6H4O4
and a molecular weight of 140.09 g/mol. Its IUPAC name is 3-ethenoxyfuran-2,5-dione.
Molecular Properties
| Compound Name | 3-ethenoxyfuran-2,5-dione |
| PubChem CID | 57056226 |
| Molecular Formula | C6H4O4 |
| Molecular Weight | 140.09 g/mol |
| Exact Mass | 140.01 |
| IUPAC Name | 3-ethenoxyfuran-2,5-dione |
| SMILES | C=COC1=CC(=O)OC1=O |
| InChI | InChI=1S/C6H4O4/c1-2-9-4-3-5(7)10-6(4)8/h2-3H,1H2 |
| InChIKey | XGIFMHGDWWCUTR-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.09 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenoxyfuran-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenoxyfuran-2,5-dione?
The IUPAC name of 3-ethenoxyfuran-2,5-dione (CID 57056226) is 3-ethenoxyfuran-2,5-dione.
What is the SMILES notation for 3-ethenoxyfuran-2,5-dione?
The canonical SMILES for 3-ethenoxyfuran-2,5-dione is C=COC1=CC(=O)OC1=O.
What is the InChIKey of 3-ethenoxyfuran-2,5-dione?
The InChIKey is XGIFMHGDWWCUTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O4/c1-2-9-4-3-5(7)10-6(4)8/h2-3H,1H2.
What are the key properties of 3-ethenoxyfuran-2,5-dione?
3-ethenoxyfuran-2,5-dione has a molecular weight of 140.09 g/mol, XLogP of 0.11, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenoxyfuran-2,5-dione is sourced from PubChem (CID 57056226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).