C15H22O6 — CID 57056464
4-[(3aS,4S,7S,7aR)-2,2-dimethyl-7-(2-oxoethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]-3-methylbut-2-enoic acid (PubChem CID 57056464) has the molecular formula C15H22O6 and a molecular weight of 298.33 g/mol. Its IUPAC name is 4-[(3aS,4S,7S,7aR)-2,2-dimethyl-7-(2-oxoethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]-3-methylbut-2-enoic acid.
| Compound Name | 4-[(3aS,4S,7S,7aR)-2,2-dimethyl-7-(2-oxoethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]-3-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 57056464 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 4-[(3aS,4S,7S,7aR)-2,2-dimethyl-7-(2-oxoethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]-3-methylbut-2-enoic acid |
| SMILES | CC(=CC(=O)O)C[C@@H]1OC[C@H](CC=O)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C15H22O6/c1-9(7-12(17)18)6-11-14-13(20-15(2,3)21-14)10(4-5-16)8-19-11/h5,7,10-11,13-14H,4,6,8H2,1-3H3,(H,17,18)/t10-,11-,13+,14-/m0/s1 |
| InChIKey | VQEQCFJJCNWGMU-VTPLQMEGSA-N |
| XLogP | 1.53 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|