C11H16O5 — CID 57056685
[(3aR,4R,5R,6aS)-4-(2-hydroxyethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate (PubChem CID 57056685) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is [(3aR,4R,5R,6aS)-4-(2-hydroxyethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate.
| Compound Name | [(3aR,4R,5R,6aS)-4-(2-hydroxyethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate |
|---|---|
| PubChem CID | 57056685 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | [(3aR,4R,5R,6aS)-4-(2-hydroxyethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H]2OC(=O)C[C@@H]2[C@H]1CCO |
| InChI | InChI=1S/C11H16O5/c1-6(13)15-9-5-10-8(4-11(14)16-10)7(9)2-3-12/h7-10,12H,2-5H2,1H3/t7-,8-,9-,10+/m1/s1 |
| InChIKey | DKHPWRXBVAMOIG-KYXWUPHJSA-N |
| XLogP | 0.25 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |