C21H36N12O2S2 — CID 57056702
[amino-[3-[(N'-carbamoylcarbamimidoyl)-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]amino]propyl-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]amino]methylidene]urea (PubChem CID 57056702) has the molecular formula C21H36N12O2S2 and a molecular weight of 552.74 g/mol. Its IUPAC name is [amino-[3-[(N'-carbamoylcarbamimidoyl)-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]amino]propyl-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]amino]methylidene]urea.
| Compound Name | [amino-[3-[(N'-carbamoylcarbamimidoyl)-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]amino]propyl-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]amino]methylidene]urea |
|---|---|
| PubChem CID | 57056702 |
| Molecular Formula | C21H36N12O2S2 |
| Molecular Weight | 552.74 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | [amino-[3-[(N'-carbamoylcarbamimidoyl)-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]amino]propyl-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]amino]methylidene]urea |
| SMILES | Cc1[nH]cnc1CSCCN(CCCN(CCSCc1nc[nH]c1C)C(N)=NC(N)=O)C(N)=NC(N)=O |
| InChI | InChI=1S/C21H36N12O2S2/c1-14-16(28-12-26-14)10-36-8-6-32(18(22)30-20(24)34)4-3-5-33(19(23)31-21(25)35)7-9-37-11-17-15(2)27-13-29-17/h12-13H,3-11H2,1-2H3,(H,26,28)(H,27,29)(H4,22,24,30,34)(H4,23,25,31,35) |
| InChIKey | VFJILKATNPROGQ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 226.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.74 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|