C24H20Cl10O3 — CID 57056740
3-ethyl-3-[[(3-ethyloxetan-3-yl)-(2,3,4,5,6-pentachlorophenyl)methoxy]-(2,3,4,5,6-pentachlorophenyl)methyl]oxetane (PubChem CID 57056740) has the molecular formula C24H20Cl10O3 and a molecular weight of 710.95 g/mol. Its IUPAC name is 3-ethyl-3-[[(3-ethyloxetan-3-yl)-(2,3,4,5,6-pentachlorophenyl)methoxy]-(2,3,4,5,6-pentachlorophenyl)methyl]oxetane.
| Compound Name | 3-ethyl-3-[[(3-ethyloxetan-3-yl)-(2,3,4,5,6-pentachlorophenyl)methoxy]-(2,3,4,5,6-pentachlorophenyl)methyl]oxetane |
|---|---|
| PubChem CID | 57056740 |
| Molecular Formula | C24H20Cl10O3 |
| Molecular Weight | 710.95 g/mol |
| Exact Mass | 705.83 |
| IUPAC Name | 3-ethyl-3-[[(3-ethyloxetan-3-yl)-(2,3,4,5,6-pentachlorophenyl)methoxy]-(2,3,4,5,6-pentachlorophenyl)methyl]oxetane |
| SMILES | CCC1(C(OC(c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)C2(CC)COC2)c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)COC1 |
| InChI | InChI=1S/C24H20Cl10O3/c1-3-23(5-35-6-23)21(9-11(25)15(29)19(33)16(30)12(9)26)37-22(24(4-2)7-36-8-24)10-13(27)17(31)20(34)18(32)14(10)28/h21-22H,3-8H2,1-2H3 |
| InChIKey | CEBZDVVPGOSVKB-UHFFFAOYSA-N |
| XLogP | 11.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.95 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|