C30H38O5 — CID 57057249
phenacyl 5-[(3aR,4S,5R,6aR)-5-hydroxy-4-[(3R,4S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate (PubChem CID 57057249) has the molecular formula C30H38O5 and a molecular weight of 478.63 g/mol. Its IUPAC name is phenacyl 5-[(3aR,4S,5R,6aR)-5-hydroxy-4-[(3R,4S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate.
| Compound Name | phenacyl 5-[(3aR,4S,5R,6aR)-5-hydroxy-4-[(3R,4S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate |
|---|---|
| PubChem CID | 57057249 |
| Molecular Formula | C30H38O5 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | phenacyl 5-[(3aR,4S,5R,6aR)-5-hydroxy-4-[(3R,4S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate |
| SMILES | CC#CC[C@H](C)[C@@H](O)C=C[C@H]1[C@@H]2CC(=CCCCC(=O)OCC(=O)c3ccccc3)C[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C30H38O5/c1-3-4-10-21(2)27(31)16-15-25-26-18-22(17-24(26)19-28(25)32)11-8-9-14-30(34)35-20-29(33)23-12-6-5-7-13-23/h5-7,11-13,15-16,21,24-28,31-32H,8-10,14,17-20H2,1-2H3/t21-,24+,25-,26+,27-,28+/m0/s1 |
| InChIKey | CZUMMMDKQYRZDP-HAWAIOCWSA-N |
| XLogP | 4.88 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|