C17H30N2O3Si — CID 57057257
2-N-(3-phenylprop-2-enyl)-5-trimethoxysilylpentane-1,2-diamine (PubChem CID 57057257) has the molecular formula C17H30N2O3Si and a molecular weight of 338.52 g/mol. Its IUPAC name is 2-N-(3-phenylprop-2-enyl)-5-trimethoxysilylpentane-1,2-diamine.
| Compound Name | 2-N-(3-phenylprop-2-enyl)-5-trimethoxysilylpentane-1,2-diamine |
|---|---|
| PubChem CID | 57057257 |
| Molecular Formula | C17H30N2O3Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 2-N-(3-phenylprop-2-enyl)-5-trimethoxysilylpentane-1,2-diamine |
| SMILES | CO[Si](CCCC(CN)NCC=Cc1ccccc1)(OC)OC |
| InChI | InChI=1S/C17H30N2O3Si/c1-20-23(21-2,22-3)14-8-12-17(15-18)19-13-7-11-16-9-5-4-6-10-16/h4-7,9-11,17,19H,8,12-15,18H2,1-3H3 |
| InChIKey | BDSCDYWPTBZLMG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|