C19H27Cl2N3 — CID 57057485
4-(5,6-dichloro-1,3-diethyl-2H-benzimidazol-2-yl)-N,N-diethylbuta-1,3-dien-1-amine (PubChem CID 57057485) has the molecular formula C19H27Cl2N3 and a molecular weight of 368.35 g/mol. Its IUPAC name is 4-(5,6-dichloro-1,3-diethyl-2H-benzimidazol-2-yl)-N,N-diethylbuta-1,3-dien-1-amine.
| Compound Name | 4-(5,6-dichloro-1,3-diethyl-2H-benzimidazol-2-yl)-N,N-diethylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 57057485 |
| Molecular Formula | C19H27Cl2N3 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 4-(5,6-dichloro-1,3-diethyl-2H-benzimidazol-2-yl)-N,N-diethylbuta-1,3-dien-1-amine |
| SMILES | CCN(C=CC=CC1N(CC)c2cc(Cl)c(Cl)cc2N1CC)CC |
| InChI | InChI=1S/C19H27Cl2N3/c1-5-22(6-2)12-10-9-11-19-23(7-3)17-13-15(20)16(21)14-18(17)24(19)8-4/h9-14,19H,5-8H2,1-4H3 |
| InChIKey | BFPWDRAEOYWCFG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|