About tetrazol-2-yl 2-[2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenyl]acetate
tetrazol-2-yl 2-[2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenyl]acetate (PubChem CID 57057491) has the molecular formula C26H21N5O4
and a molecular weight of 467.49 g/mol. Its IUPAC name is tetrazol-2-yl 2-[2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenyl]acetate.
Molecular Properties
| Compound Name | tetrazol-2-yl 2-[2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenyl]acetate |
| PubChem CID | 57057491 |
| Molecular Formula | C26H21N5O4 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | tetrazol-2-yl 2-[2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenyl]acetate |
| SMILES | O=C(Cc1ccccc1COc1cccc(OCc2ccc3ccccc3n2)c1)On1ncnn1 |
| InChI | InChI=1S/C26H21N5O4/c32-26(35-31-28-18-27-30-31)14-20-7-1-2-8-21(20)16-33-23-9-5-10-24(15-23)34-17-22-13-12-19-6-3-4-11-25(19)29-22/h1-13,15,18H,14,16-17H2 |
| InChIKey | DUDMYINLOUGERE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 101.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'} |
|---|
Analyze tetrazol-2-yl 2-[2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrazol-2-yl 2-[2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenyl]acetate?
The IUPAC name of tetrazol-2-yl 2-[2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenyl]acetate (CID 57057491) is tetrazol-2-yl 2-[2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenyl]acetate.
What is the SMILES notation for tetrazol-2-yl 2-[2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenyl]acetate?
The canonical SMILES for tetrazol-2-yl 2-[2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenyl]acetate is O=C(Cc1ccccc1COc1cccc(OCc2ccc3ccccc3n2)c1)On1ncnn1.
What is the InChIKey of tetrazol-2-yl 2-[2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenyl]acetate?
The InChIKey is DUDMYINLOUGERE-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21N5O4/c32-26(35-31-28-18-27-30-31)14-20-7-1-2-8-21(20)16-33-23-9-5-10-24(15-23)34-17-22-13-12-19-6-3-4-11-25(19)29-22/h1-13,15,18H,14,16-17H2.
What are the key properties of tetrazol-2-yl 2-[2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenyl]acetate?
tetrazol-2-yl 2-[2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenyl]acetate has a molecular weight of 467.49 g/mol, XLogP of 3.58, 9 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for tetrazol-2-yl 2-[2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenyl]acetate is sourced from PubChem (CID 57057491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).