C26H48O4Si — CID 57057500
methyl (3S)-7-[(1R,3aS,4R,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-hydroxy-3-methyloct-5-enoate (PubChem CID 57057500) has the molecular formula C26H48O4Si and a molecular weight of 452.75 g/mol. Its IUPAC name is methyl (3S)-7-[(1R,3aS,4R,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-hydroxy-3-methyloct-5-enoate.
| Compound Name | methyl (3S)-7-[(1R,3aS,4R,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-hydroxy-3-methyloct-5-enoate |
|---|---|
| PubChem CID | 57057500 |
| Molecular Formula | C26H48O4Si |
| Molecular Weight | 452.75 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | methyl (3S)-7-[(1R,3aS,4R,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-hydroxy-3-methyloct-5-enoate |
| SMILES | COC(=O)C[C@@](C)(O)CC=CC(C)[C@H]1CC[C@@H]2[C@H](O[Si](C)(C)C(C)(C)C)CCC[C@@]12C |
| InChI | InChI=1S/C26H48O4Si/c1-19(12-10-16-25(5,28)18-23(27)29-7)20-14-15-21-22(13-11-17-26(20,21)6)30-31(8,9)24(2,3)4/h10,12,19-22,28H,11,13-18H2,1-9H3/t19?,20-,21-,22-,25+,26+/m1/s1 |
| InChIKey | MRJBLFOKFUALQV-UUVAGXRJSA-N |
| XLogP | 6.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.75 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|