C13H22N8OS — CID 57058574
2-cyano-1-[1-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]butan-2-yl]-1-(2-methoxyethyl)guanidine (PubChem CID 57058574) has the molecular formula C13H22N8OS and a molecular weight of 338.44 g/mol. Its IUPAC name is 2-cyano-1-[1-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]butan-2-yl]-1-(2-methoxyethyl)guanidine.
| Compound Name | 2-cyano-1-[1-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]butan-2-yl]-1-(2-methoxyethyl)guanidine |
|---|---|
| PubChem CID | 57058574 |
| Molecular Formula | C13H22N8OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 2-cyano-1-[1-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]butan-2-yl]-1-(2-methoxyethyl)guanidine |
| SMILES | CCC(Cc1csc(N=C(N)N)n1)N(CCOC)/C(N)=N/C#N |
| InChI | InChI=1S/C13H22N8OS/c1-3-10(21(4-5-22-2)12(17)18-8-14)6-9-7-23-13(19-9)20-11(15)16/h7,10H,3-6H2,1-2H3,(H2,17,18)(H4,15,16,19,20) |
| InChIKey | DOBDXSRYYQGBAF-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 151.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|