About purine-9-carboxylic acid
purine-9-carboxylic acid (PubChem CID 57058588) has the molecular formula C6H4N4O2
and a molecular weight of 164.12 g/mol. Its IUPAC name is purine-9-carboxylic acid.
Molecular Properties
| Compound Name | purine-9-carboxylic acid |
| PubChem CID | 57058588 |
| Molecular Formula | C6H4N4O2 |
| Molecular Weight | 164.12 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | purine-9-carboxylic acid |
| SMILES | O=C(O)n1cnc2cncnc21 |
| InChI | InChI=1S/C6H4N4O2/c11-6(12)10-3-9-4-1-7-2-8-5(4)10/h1-3H,(H,11,12) |
| InChIKey | HSPSAHJIYRPTJW-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.12 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze purine-9-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of purine-9-carboxylic acid?
The IUPAC name of purine-9-carboxylic acid (CID 57058588) is purine-9-carboxylic acid.
What is the SMILES notation for purine-9-carboxylic acid?
The canonical SMILES for purine-9-carboxylic acid is O=C(O)n1cnc2cncnc21.
What is the InChIKey of purine-9-carboxylic acid?
The InChIKey is HSPSAHJIYRPTJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4O2/c11-6(12)10-3-9-4-1-7-2-8-5(4)10/h1-3H,(H,11,12).
What are the key properties of purine-9-carboxylic acid?
purine-9-carboxylic acid has a molecular weight of 164.12 g/mol, XLogP of 0.35, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for purine-9-carboxylic acid is sourced from PubChem (CID 57058588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).