C28H28N2O4 — CID 57058744
2-[[6-[3-[(1-phenyl-2-pyridin-3-ylethenyl)amino]oxyprop-1-enyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid (PubChem CID 57058744) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is 2-[[6-[3-[(1-phenyl-2-pyridin-3-ylethenyl)amino]oxyprop-1-enyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid.
| Compound Name | 2-[[6-[3-[(1-phenyl-2-pyridin-3-ylethenyl)amino]oxyprop-1-enyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 57058744 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 2-[[6-[3-[(1-phenyl-2-pyridin-3-ylethenyl)amino]oxyprop-1-enyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
| SMILES | O=C(O)COc1cccc2c1CCC(C=CCONC(=Cc1cccnc1)c1ccccc1)C2 |
| InChI | InChI=1S/C28H28N2O4/c31-28(32)20-33-27-12-4-11-24-17-21(13-14-25(24)27)8-6-16-34-30-26(23-9-2-1-3-10-23)18-22-7-5-15-29-19-22/h1-12,15,18-19,21,30H,13-14,16-17,20H2,(H,31,32) |
| InChIKey | LSMXYJJSPGHGQO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|