C7H11NO2 — CID 57058800
4-butyl-4H-1,3-oxazol-5-one (PubChem CID 57058800) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is 4-butyl-4H-1,3-oxazol-5-one.
| Compound Name | 4-butyl-4H-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 57058800 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 4-butyl-4H-1,3-oxazol-5-one |
| SMILES | CCCCC1N=COC1=O |
| InChI | InChI=1S/C7H11NO2/c1-2-3-4-6-7(9)10-5-8-6/h5-6H,2-4H2,1H3 |
| InChIKey | UQQBIVIMTYLQRS-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |