About 3-ethyl-6-methylhepta-4,5-dien-1-yne
3-ethyl-6-methylhepta-4,5-dien-1-yne (PubChem CID 57058949) has the molecular formula C10H14
and a molecular weight of 134.22 g/mol. Its IUPAC name is 3-ethyl-6-methylhepta-4,5-dien-1-yne.
Molecular Properties
| Compound Name | 3-ethyl-6-methylhepta-4,5-dien-1-yne |
| PubChem CID | 57058949 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | 3-ethyl-6-methylhepta-4,5-dien-1-yne |
| SMILES | C#CC(C=C=C(C)C)CC |
| InChI | InChI=1S/C10H14/c1-5-10(6-2)8-7-9(3)4/h1,8,10H,6H2,2-4H3 |
| InChIKey | VWCQIFMTDQQJSO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-6-methylhepta-4,5-dien-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-6-methylhepta-4,5-dien-1-yne?
The IUPAC name of 3-ethyl-6-methylhepta-4,5-dien-1-yne (CID 57058949) is 3-ethyl-6-methylhepta-4,5-dien-1-yne.
What is the SMILES notation for 3-ethyl-6-methylhepta-4,5-dien-1-yne?
The canonical SMILES for 3-ethyl-6-methylhepta-4,5-dien-1-yne is C#CC(C=C=C(C)C)CC.
What is the InChIKey of 3-ethyl-6-methylhepta-4,5-dien-1-yne?
The InChIKey is VWCQIFMTDQQJSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14/c1-5-10(6-2)8-7-9(3)4/h1,8,10H,6H2,2-4H3.
What are the key properties of 3-ethyl-6-methylhepta-4,5-dien-1-yne?
3-ethyl-6-methylhepta-4,5-dien-1-yne has a molecular weight of 134.22 g/mol, XLogP of 2.77, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-6-methylhepta-4,5-dien-1-yne is sourced from PubChem (CID 57058949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).