About pyrazin-2-ylmethanediol
pyrazin-2-ylmethanediol (PubChem CID 57059322) has the molecular formula C5H6N2O2
and a molecular weight of 126.11 g/mol. Its IUPAC name is pyrazin-2-ylmethanediol.
Molecular Properties
| Compound Name | pyrazin-2-ylmethanediol |
| PubChem CID | 57059322 |
| Molecular Formula | C5H6N2O2 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.04 |
| IUPAC Name | pyrazin-2-ylmethanediol |
| SMILES | OC(O)c1cnccn1 |
| InChI | InChI=1S/C5H6N2O2/c8-5(9)4-3-6-1-2-7-4/h1-3,5,8-9H |
| InChIKey | GZMYGHVWJARSKL-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze pyrazin-2-ylmethanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazin-2-ylmethanediol?
The IUPAC name of pyrazin-2-ylmethanediol (CID 57059322) is pyrazin-2-ylmethanediol.
What is the SMILES notation for pyrazin-2-ylmethanediol?
The canonical SMILES for pyrazin-2-ylmethanediol is OC(O)c1cnccn1.
What is the InChIKey of pyrazin-2-ylmethanediol?
The InChIKey is GZMYGHVWJARSKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2/c8-5(9)4-3-6-1-2-7-4/h1-3,5,8-9H.
What are the key properties of pyrazin-2-ylmethanediol?
pyrazin-2-ylmethanediol has a molecular weight of 126.11 g/mol, XLogP of -0.54, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazin-2-ylmethanediol is sourced from PubChem (CID 57059322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).