C21H35BrO3 — CID 57059352
ethyl (2S,6R)-6-[(1R,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-hydroxy-2-methylheptanoate (PubChem CID 57059352) has the molecular formula C21H35BrO3 and a molecular weight of 415.41 g/mol. Its IUPAC name is ethyl (2S,6R)-6-[(1R,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-hydroxy-2-methylheptanoate.
| Compound Name | ethyl (2S,6R)-6-[(1R,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-hydroxy-2-methylheptanoate |
|---|---|
| PubChem CID | 57059352 |
| Molecular Formula | C21H35BrO3 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | ethyl (2S,6R)-6-[(1R,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-hydroxy-2-methylheptanoate |
| SMILES | CCOC(=O)[C@@](C)(O)CCC[C@@H](C)[C@H]1CCC2C(=CBr)CCC[C@@]21C |
| InChI | InChI=1S/C21H35BrO3/c1-5-25-19(23)21(4,24)13-6-8-15(2)17-10-11-18-16(14-22)9-7-12-20(17,18)3/h14-15,17-18,24H,5-13H2,1-4H3/t15-,17-,18?,20-,21+/m1/s1 |
| InChIKey | ZINVUMAANMXPIN-JPAXMSFJSA-N |
| XLogP | 5.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |