About 2-[2-aminoethyl-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethyl]amino]acetic acid
2-[2-aminoethyl-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethyl]amino]acetic acid (PubChem CID 57059522) has the molecular formula C10H15N3O6
and a molecular weight of 273.24 g/mol. Its IUPAC name is 2-[2-aminoethyl-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethyl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[2-aminoethyl-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethyl]amino]acetic acid |
| PubChem CID | 57059522 |
| Molecular Formula | C10H15N3O6 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2-[2-aminoethyl-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethyl]amino]acetic acid |
| SMILES | NCCN(CC(=O)O)CC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C10H15N3O6/c11-3-4-12(5-9(16)17)6-10(18)19-13-7(14)1-2-8(13)15/h1-2,14-15H,3-6,11H2,(H,16,17) |
| InChIKey | ZTDBCGSDHBKSIU-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 138.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[2-aminoethyl-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethyl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-aminoethyl-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethyl]amino]acetic acid?
The IUPAC name of 2-[2-aminoethyl-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethyl]amino]acetic acid (CID 57059522) is 2-[2-aminoethyl-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethyl]amino]acetic acid.
What is the SMILES notation for 2-[2-aminoethyl-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethyl]amino]acetic acid?
The canonical SMILES for 2-[2-aminoethyl-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethyl]amino]acetic acid is NCCN(CC(=O)O)CC(=O)On1c(O)ccc1O.
What is the InChIKey of 2-[2-aminoethyl-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethyl]amino]acetic acid?
The InChIKey is ZTDBCGSDHBKSIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O6/c11-3-4-12(5-9(16)17)6-10(18)19-13-7(14)1-2-8(13)15/h1-2,14-15H,3-6,11H2,(H,16,17).
What are the key properties of 2-[2-aminoethyl-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethyl]amino]acetic acid?
2-[2-aminoethyl-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethyl]amino]acetic acid has a molecular weight of 273.24 g/mol, XLogP of -1.80, 7 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-aminoethyl-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethyl]amino]acetic acid is sourced from PubChem (CID 57059522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).