C29H39N3O5 — CID 57059748
dibenzyl (2R)-2-[(2S)-2,6-diaminohexanoyl]-1-propylpyrrolidine-2,3-dicarboxylate (PubChem CID 57059748) has the molecular formula C29H39N3O5 and a molecular weight of 509.65 g/mol. Its IUPAC name is dibenzyl (2R)-2-[(2S)-2,6-diaminohexanoyl]-1-propylpyrrolidine-2,3-dicarboxylate.
| Compound Name | dibenzyl (2R)-2-[(2S)-2,6-diaminohexanoyl]-1-propylpyrrolidine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 57059748 |
| Molecular Formula | C29H39N3O5 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.29 |
| IUPAC Name | dibenzyl (2R)-2-[(2S)-2,6-diaminohexanoyl]-1-propylpyrrolidine-2,3-dicarboxylate |
| SMILES | CCCN1CCC(C(=O)OCc2ccccc2)[C@]1(C(=O)OCc1ccccc1)C(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C29H39N3O5/c1-2-18-32-19-16-24(27(34)36-20-22-11-5-3-6-12-22)29(32,26(33)25(31)15-9-10-17-30)28(35)37-21-23-13-7-4-8-14-23/h3-8,11-14,24-25H,2,9-10,15-21,30-31H2,1H3/t24?,25-,29+/m0/s1 |
| InChIKey | NAJDHKZQRGOPDV-ZZEMQPTCSA-N |
| XLogP | 2.97 |
| TPSA | 124.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|