C38H40F3N5O4 — CID 57059785
N-[(2R)-1-[(2R,4S)-2-benzyl-4-[quinolin-4-ylmethyl-(2,2,2-trifluoroacetyl)amino]piperidin-1-yl]-1-oxo-3-phenylpropan-2-yl]-4-formamidobutanamide (PubChem CID 57059785) has the molecular formula C38H40F3N5O4 and a molecular weight of 687.76 g/mol. Its IUPAC name is N-[(2R)-1-[(2R,4S)-2-benzyl-4-[quinolin-4-ylmethyl-(2,2,2-trifluoroacetyl)amino]piperidin-1-yl]-1-oxo-3-phenylpropan-2-yl]-4-formamidobutanamide.
| Compound Name | N-[(2R)-1-[(2R,4S)-2-benzyl-4-[quinolin-4-ylmethyl-(2,2,2-trifluoroacetyl)amino]piperidin-1-yl]-1-oxo-3-phenylpropan-2-yl]-4-formamidobutanamide |
|---|---|
| PubChem CID | 57059785 |
| Molecular Formula | C38H40F3N5O4 |
| Molecular Weight | 687.76 g/mol |
| Exact Mass | 687.30 |
| IUPAC Name | N-[(2R)-1-[(2R,4S)-2-benzyl-4-[quinolin-4-ylmethyl-(2,2,2-trifluoroacetyl)amino]piperidin-1-yl]-1-oxo-3-phenylpropan-2-yl]-4-formamidobutanamide |
| SMILES | O=CNCCCC(=O)N[C@H](Cc1ccccc1)C(=O)N1CC[C@H](N(Cc2ccnc3ccccc23)C(=O)C(F)(F)F)C[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C38H40F3N5O4/c39-38(40,41)37(50)46(25-29-17-20-43-33-15-8-7-14-32(29)33)30-18-21-45(31(24-30)22-27-10-3-1-4-11-27)36(49)34(23-28-12-5-2-6-13-28)44-35(48)16-9-19-42-26-47/h1-8,10-15,17,20,26,30-31,34H,9,16,18-19,21-25H2,(H,42,47)(H,44,48)/t30-,31+,34+/m0/s1 |
| InChIKey | NFEVSUQCBXGTET-BEJSXWRTSA-N |
| XLogP | 4.98 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.76 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|