C25H36ClN5O — CID 57060050
N'-(4-aminobutyl)-N'-(3-aminopropyl)-1-(6-chloro-2-methoxyacridin-9-yl)butane-1,4-diamine (PubChem CID 57060050) has the molecular formula C25H36ClN5O and a molecular weight of 458.05 g/mol. Its IUPAC name is N'-(4-aminobutyl)-N'-(3-aminopropyl)-1-(6-chloro-2-methoxyacridin-9-yl)butane-1,4-diamine.
| Compound Name | N'-(4-aminobutyl)-N'-(3-aminopropyl)-1-(6-chloro-2-methoxyacridin-9-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 57060050 |
| Molecular Formula | C25H36ClN5O |
| Molecular Weight | 458.05 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | N'-(4-aminobutyl)-N'-(3-aminopropyl)-1-(6-chloro-2-methoxyacridin-9-yl)butane-1,4-diamine |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(C(N)CCCN(CCCN)CCCCN)c2c1 |
| InChI | InChI=1S/C25H36ClN5O/c1-32-19-8-10-23-21(17-19)25(20-9-7-18(26)16-24(20)30-23)22(29)6-4-14-31(15-5-12-28)13-3-2-11-27/h7-10,16-17,22H,2-6,11-15,27-29H2,1H3 |
| InChIKey | CGWBOILWRCFOIC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.05 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|