C7H5F5 — CID 57060343
3-ethenyl-2,4,5,5,5-pentafluoropenta-1,3-diene (PubChem CID 57060343) has the molecular formula C7H5F5 and a molecular weight of 184.11 g/mol. Its IUPAC name is 3-ethenyl-2,4,5,5,5-pentafluoropenta-1,3-diene.
| Compound Name | 3-ethenyl-2,4,5,5,5-pentafluoropenta-1,3-diene |
|---|---|
| PubChem CID | 57060343 |
| Molecular Formula | C7H5F5 |
| Molecular Weight | 184.11 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | 3-ethenyl-2,4,5,5,5-pentafluoropenta-1,3-diene |
| SMILES | C=CC(C(=C)F)=C(F)C(F)(F)F |
| InChI | InChI=1S/C7H5F5/c1-3-5(4(2)8)6(9)7(10,11)12/h3H,1-2H2 |
| InChIKey | MWGWIOYIONVGQL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.11 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|