C17H23NO — CID 57060430
(10bS)-3-methyl-4-prop-2-enyl-1,2,3,6,6a,8,10a,10b-octahydrobenzo[f]quinolin-7-one (PubChem CID 57060430) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is (10bS)-3-methyl-4-prop-2-enyl-1,2,3,6,6a,8,10a,10b-octahydrobenzo[f]quinolin-7-one.
| Compound Name | (10bS)-3-methyl-4-prop-2-enyl-1,2,3,6,6a,8,10a,10b-octahydrobenzo[f]quinolin-7-one |
|---|---|
| PubChem CID | 57060430 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | (10bS)-3-methyl-4-prop-2-enyl-1,2,3,6,6a,8,10a,10b-octahydrobenzo[f]quinolin-7-one |
| SMILES | C=CCN1C2=CCC3C(=O)CC=CC3[C@@H]2CCC1C |
| InChI | InChI=1S/C17H23NO/c1-3-11-18-12(2)7-8-14-13-5-4-6-17(19)15(13)9-10-16(14)18/h3-5,10,12-15H,1,6-9,11H2,2H3/t12?,13?,14-,15?/m0/s1 |
| InChIKey | ZRORPLTXMXVELP-YFXXHVASSA-N |
| XLogP | 3.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|