C16H26O — CID 57060640
(1S,2S,5S,7R,8R)-2,6,6,8-tetramethyltricyclo[5.3.1.01,5]undecane-2-carbaldehyde (PubChem CID 57060640) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is (1S,2S,5S,7R,8R)-2,6,6,8-tetramethyltricyclo[5.3.1.01,5]undecane-2-carbaldehyde.
| Compound Name | (1S,2S,5S,7R,8R)-2,6,6,8-tetramethyltricyclo[5.3.1.01,5]undecane-2-carbaldehyde |
|---|---|
| PubChem CID | 57060640 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | (1S,2S,5S,7R,8R)-2,6,6,8-tetramethyltricyclo[5.3.1.01,5]undecane-2-carbaldehyde |
| SMILES | C[C@@H]1CC[C@]23C[C@H]1C(C)(C)[C@@H]2CC[C@]3(C)C=O |
| InChI | InChI=1S/C16H26O/c1-11-5-8-16-9-12(11)14(2,3)13(16)6-7-15(16,4)10-17/h10-13H,5-9H2,1-4H3/t11-,12-,13+,15-,16+/m1/s1 |
| InChIKey | VLPBLKKZCRRKKU-QUEVPRLRSA-N |
| XLogP | 4.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|