C17H24N4O4S — CID 57060779
2-[[[5-[cyanomethyl(sulfino)amino]-2-methoxybenzoyl]amino]methyl]-1-ethylpyrrolidine (PubChem CID 57060779) has the molecular formula C17H24N4O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is 2-[[[5-[cyanomethyl(sulfino)amino]-2-methoxybenzoyl]amino]methyl]-1-ethylpyrrolidine.
| Compound Name | 2-[[[5-[cyanomethyl(sulfino)amino]-2-methoxybenzoyl]amino]methyl]-1-ethylpyrrolidine |
|---|---|
| PubChem CID | 57060779 |
| Molecular Formula | C17H24N4O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 2-[[[5-[cyanomethyl(sulfino)amino]-2-methoxybenzoyl]amino]methyl]-1-ethylpyrrolidine |
| SMILES | CCN1CCCC1CNC(=O)c1cc(N(CC#N)S(=O)O)ccc1OC |
| InChI | InChI=1S/C17H24N4O4S/c1-3-20-9-4-5-14(20)12-19-17(22)15-11-13(6-7-16(15)25-2)21(10-8-18)26(23)24/h6-7,11,14H,3-5,9-10,12H2,1-2H3,(H,19,22)(H,23,24) |
| InChIKey | XZQHOLHNPNKBBB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|