C14H19O2P — CID 57060971
7-diethylphosphanyloxy-2-methyl-2,3-dihydroinden-1-one (PubChem CID 57060971) has the molecular formula C14H19O2P and a molecular weight of 250.28 g/mol. Its IUPAC name is 7-diethylphosphanyloxy-2-methyl-2,3-dihydroinden-1-one.
| Compound Name | 7-diethylphosphanyloxy-2-methyl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 57060971 |
| Molecular Formula | C14H19O2P |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 7-diethylphosphanyloxy-2-methyl-2,3-dihydroinden-1-one |
| SMILES | CCP(CC)Oc1cccc2c1C(=O)C(C)C2 |
| InChI | InChI=1S/C14H19O2P/c1-4-17(5-2)16-12-8-6-7-11-9-10(3)14(15)13(11)12/h6-8,10H,4-5,9H2,1-3H3 |
| InChIKey | ZNCYQUQFFKTUGF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|