C39H57O3P — CID 57061157
1,1-bis(2-tert-butyl-4-methylphenyl)ethyl (2,6-ditert-butyl-4-methylphenyl) hydrogen phosphite (PubChem CID 57061157) has the molecular formula C39H57O3P and a molecular weight of 604.86 g/mol. Its IUPAC name is 1,1-bis(2-tert-butyl-4-methylphenyl)ethyl (2,6-ditert-butyl-4-methylphenyl) hydrogen phosphite.
| Compound Name | 1,1-bis(2-tert-butyl-4-methylphenyl)ethyl (2,6-ditert-butyl-4-methylphenyl) hydrogen phosphite |
|---|---|
| PubChem CID | 57061157 |
| Molecular Formula | C39H57O3P |
| Molecular Weight | 604.86 g/mol |
| Exact Mass | 604.40 |
| IUPAC Name | 1,1-bis(2-tert-butyl-4-methylphenyl)ethyl (2,6-ditert-butyl-4-methylphenyl) hydrogen phosphite |
| SMILES | Cc1ccc(C(C)(OP(O)Oc2c(C(C)(C)C)cc(C)cc2C(C)(C)C)c2ccc(C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C39H57O3P/c1-25-17-19-28(30(21-25)35(4,5)6)39(16,29-20-18-26(2)22-31(29)36(7,8)9)42-43(40)41-34-32(37(10,11)12)23-27(3)24-33(34)38(13,14)15/h17-24,40H,1-16H3 |
| InChIKey | PMGLIVLAMSRXLJ-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.86 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|