About 11-butyl-2-cyclopentyl-1-azacyclododeca-4,8,12-triene
11-butyl-2-cyclopentyl-1-azacyclododeca-4,8,12-triene (PubChem CID 57061422) has the molecular formula C20H33N
and a molecular weight of 287.49 g/mol. Its IUPAC name is 11-butyl-2-cyclopentyl-1-azacyclododeca-4,8,12-triene.
Molecular Properties
| Compound Name | 11-butyl-2-cyclopentyl-1-azacyclododeca-4,8,12-triene |
| PubChem CID | 57061422 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | 11-butyl-2-cyclopentyl-1-azacyclododeca-4,8,12-triene |
| SMILES | CCCCC1/C=N\C(C2CCCC2)CC=CCCC=CC1 |
| InChI | InChI=1S/C20H33N/c1-2-3-12-18-13-8-6-4-5-7-9-16-20(21-17-18)19-14-10-11-15-19/h6-9,17-20H,2-5,10-16H2,1H3/b8-6?,9-7?,21-17- |
| InChIKey | CMRDPWIOEZHJIO-OBRHMSDMSA-N |
| XLogP | 6.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 11-butyl-2-cyclopentyl-1-azacyclododeca-4,8,12-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-butyl-2-cyclopentyl-1-azacyclododeca-4,8,12-triene?
The IUPAC name of 11-butyl-2-cyclopentyl-1-azacyclododeca-4,8,12-triene (CID 57061422) is 11-butyl-2-cyclopentyl-1-azacyclododeca-4,8,12-triene.
What is the SMILES notation for 11-butyl-2-cyclopentyl-1-azacyclododeca-4,8,12-triene?
The canonical SMILES for 11-butyl-2-cyclopentyl-1-azacyclododeca-4,8,12-triene is CCCCC1/C=N\C(C2CCCC2)CC=CCCC=CC1.
What is the InChIKey of 11-butyl-2-cyclopentyl-1-azacyclododeca-4,8,12-triene?
The InChIKey is CMRDPWIOEZHJIO-OBRHMSDMSA-N. The full InChI is InChI=1S/C20H33N/c1-2-3-12-18-13-8-6-4-5-7-9-16-20(21-17-18)19-14-10-11-15-19/h6-9,17-20H,2-5,10-16H2,1H3/b8-6?,9-7?,21-17-.
What are the key properties of 11-butyl-2-cyclopentyl-1-azacyclododeca-4,8,12-triene?
11-butyl-2-cyclopentyl-1-azacyclododeca-4,8,12-triene has a molecular weight of 287.49 g/mol, XLogP of 6.11, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 11-butyl-2-cyclopentyl-1-azacyclododeca-4,8,12-triene is sourced from PubChem (CID 57061422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).