C34H20N2O8 — CID 57061746
4,8-bis[4-(3-aminophenoxy)phenyl]furo[3,4-f][2]benzofuran-1,3,5,7-tetrone (PubChem CID 57061746) has the molecular formula C34H20N2O8 and a molecular weight of 584.54 g/mol. Its IUPAC name is 4,8-bis[4-(3-aminophenoxy)phenyl]furo[3,4-f][2]benzofuran-1,3,5,7-tetrone.
| Compound Name | 4,8-bis[4-(3-aminophenoxy)phenyl]furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 57061746 |
| Molecular Formula | C34H20N2O8 |
| Molecular Weight | 584.54 g/mol |
| Exact Mass | 584.12 |
| IUPAC Name | 4,8-bis[4-(3-aminophenoxy)phenyl]furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
| SMILES | Nc1cccc(Oc2ccc(-c3c4c(=O)oc(=O)c4c(-c4ccc(Oc5cccc(N)c5)cc4)c4c(=O)oc(=O)c34)cc2)c1 |
| InChI | InChI=1S/C34H20N2O8/c35-19-3-1-5-23(15-19)41-21-11-7-17(8-12-21)25-27-29(33(39)43-31(27)37)26(30-28(25)32(38)44-34(30)40)18-9-13-22(14-10-18)42-24-6-2-4-20(36)16-24/h1-16H,35-36H2 |
| InChIKey | VRJKFMZRJTYSFI-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 165.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.54 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|