C18H24F6O2 — CID 57062248
(3aR,4S,7aS)-7a-methyl-1-[(2R)-7,7,7-trifluoro-6-hydroxy-6-(trifluoromethyl)hept-4-en-2-yl]-3,3a,4,5,6,7-hexahydroinden-4-ol (PubChem CID 57062248) has the molecular formula C18H24F6O2 and a molecular weight of 386.38 g/mol. Its IUPAC name is (3aR,4S,7aS)-7a-methyl-1-[(2R)-7,7,7-trifluoro-6-hydroxy-6-(trifluoromethyl)hept-4-en-2-yl]-3,3a,4,5,6,7-hexahydroinden-4-ol.
| Compound Name | (3aR,4S,7aS)-7a-methyl-1-[(2R)-7,7,7-trifluoro-6-hydroxy-6-(trifluoromethyl)hept-4-en-2-yl]-3,3a,4,5,6,7-hexahydroinden-4-ol |
|---|---|
| PubChem CID | 57062248 |
| Molecular Formula | C18H24F6O2 |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (3aR,4S,7aS)-7a-methyl-1-[(2R)-7,7,7-trifluoro-6-hydroxy-6-(trifluoromethyl)hept-4-en-2-yl]-3,3a,4,5,6,7-hexahydroinden-4-ol |
| SMILES | C[C@H](CC=CC(O)(C(F)(F)F)C(F)(F)F)C1=CC[C@H]2[C@@H](O)CCC[C@]12C |
| InChI | InChI=1S/C18H24F6O2/c1-11(5-3-10-16(26,17(19,20)21)18(22,23)24)12-7-8-13-14(25)6-4-9-15(12,13)2/h3,7,10-11,13-14,25-26H,4-6,8-9H2,1-2H3/t11-,13+,14+,15-/m1/s1 |
| InChIKey | LUIFDTXPFXIRLF-UQOMUDLDSA-N |
| XLogP | 4.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|