C36H46N2O4 — CID 57062341
[(6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl 7-[(1R,2S)-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate (PubChem CID 57062341) has the molecular formula C36H46N2O4 and a molecular weight of 570.77 g/mol. Its IUPAC name is [(6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl 7-[(1R,2S)-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate.
| Compound Name | [(6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl 7-[(1R,2S)-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 57062341 |
| Molecular Formula | C36H46N2O4 |
| Molecular Weight | 570.77 g/mol |
| Exact Mass | 570.35 |
| IUPAC Name | [(6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl 7-[(1R,2S)-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate |
| SMILES | CCCCC[C@H](O)C=C[C@H]1C=CC(=O)[C@@H]1CC=CCCCC(=O)OC[C@@H]1C=C2c3cccc4[nH]cc(c34)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C36H46N2O4/c1-3-4-7-11-28(39)18-16-26-17-19-34(40)29(26)12-8-5-6-9-15-35(41)42-24-25-20-31-30-13-10-14-32-36(30)27(22-37-32)21-33(31)38(2)23-25/h5,8,10,13-14,16-20,22,25-26,28-29,33,37,39H,3-4,6-7,9,11-12,15,21,23-24H2,1-2H3/t25-,26+,28+,29-,33-/m1/s1 |
| InChIKey | IPFWMFKESOOXNW-JMLXUYFMSA-N |
| XLogP | 6.57 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.77 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|