About (5,8-diacetyloxy-9,10-dioxoanthracen-2-yl) acetate
(5,8-diacetyloxy-9,10-dioxoanthracen-2-yl) acetate (PubChem CID 57062472) has the molecular formula C20H14O8
and a molecular weight of 382.32 g/mol. Its IUPAC name is (5,8-diacetyloxy-9,10-dioxoanthracen-2-yl) acetate.
Molecular Properties
| Compound Name | (5,8-diacetyloxy-9,10-dioxoanthracen-2-yl) acetate |
| PubChem CID | 57062472 |
| Molecular Formula | C20H14O8 |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | (5,8-diacetyloxy-9,10-dioxoanthracen-2-yl) acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)C(=O)c1c(OC(C)=O)ccc(OC(C)=O)c1C2=O |
| InChI | InChI=1S/C20H14O8/c1-9(21)26-12-4-5-13-14(8-12)20(25)18-16(28-11(3)23)7-6-15(27-10(2)22)17(18)19(13)24/h4-8H,1-3H3 |
| InChIKey | FYBWXCZUQXXIEW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (5,8-diacetyloxy-9,10-dioxoanthracen-2-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,8-diacetyloxy-9,10-dioxoanthracen-2-yl) acetate?
The IUPAC name of (5,8-diacetyloxy-9,10-dioxoanthracen-2-yl) acetate (CID 57062472) is (5,8-diacetyloxy-9,10-dioxoanthracen-2-yl) acetate.
What is the SMILES notation for (5,8-diacetyloxy-9,10-dioxoanthracen-2-yl) acetate?
The canonical SMILES for (5,8-diacetyloxy-9,10-dioxoanthracen-2-yl) acetate is CC(=O)Oc1ccc2c(c1)C(=O)c1c(OC(C)=O)ccc(OC(C)=O)c1C2=O.
What is the InChIKey of (5,8-diacetyloxy-9,10-dioxoanthracen-2-yl) acetate?
The InChIKey is FYBWXCZUQXXIEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14O8/c1-9(21)26-12-4-5-13-14(8-12)20(25)18-16(28-11(3)23)7-6-15(27-10(2)22)17(18)19(13)24/h4-8H,1-3H3.
What are the key properties of (5,8-diacetyloxy-9,10-dioxoanthracen-2-yl) acetate?
(5,8-diacetyloxy-9,10-dioxoanthracen-2-yl) acetate has a molecular weight of 382.32 g/mol, XLogP of 2.24, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (5,8-diacetyloxy-9,10-dioxoanthracen-2-yl) acetate is sourced from PubChem (CID 57062472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).