About [6-(2-fluorophenyl)-2-phenyl-4H-imidazo[1,2-a][1,4]benzodiazepin-8-yl] methyl carbonate
[6-(2-fluorophenyl)-2-phenyl-4H-imidazo[1,2-a][1,4]benzodiazepin-8-yl] methyl carbonate (PubChem CID 57062538) has the molecular formula C25H18FN3O3
and a molecular weight of 427.44 g/mol. Its IUPAC name is [6-(2-fluorophenyl)-2-phenyl-4H-imidazo[1,2-a][1,4]benzodiazepin-8-yl] methyl carbonate.
Molecular Properties
| Compound Name | [6-(2-fluorophenyl)-2-phenyl-4H-imidazo[1,2-a][1,4]benzodiazepin-8-yl] methyl carbonate |
| PubChem CID | 57062538 |
| Molecular Formula | C25H18FN3O3 |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | [6-(2-fluorophenyl)-2-phenyl-4H-imidazo[1,2-a][1,4]benzodiazepin-8-yl] methyl carbonate |
| SMILES | COC(=O)Oc1ccc2c(c1)C(c1ccccc1F)=NCc1nc(-c3ccccc3)cn1-2 |
| InChI | InChI=1S/C25H18FN3O3/c1-31-25(30)32-17-11-12-22-19(13-17)24(18-9-5-6-10-20(18)26)27-14-23-28-21(15-29(22)23)16-7-3-2-4-8-16/h2-13,15H,14H2,1H3 |
| InChIKey | KKFRYIOKIQTLFO-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [6-(2-fluorophenyl)-2-phenyl-4H-imidazo[1,2-a][1,4]benzodiazepin-8-yl] methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(2-fluorophenyl)-2-phenyl-4H-imidazo[1,2-a][1,4]benzodiazepin-8-yl] methyl carbonate?
The IUPAC name of [6-(2-fluorophenyl)-2-phenyl-4H-imidazo[1,2-a][1,4]benzodiazepin-8-yl] methyl carbonate (CID 57062538) is [6-(2-fluorophenyl)-2-phenyl-4H-imidazo[1,2-a][1,4]benzodiazepin-8-yl] methyl carbonate.
What is the SMILES notation for [6-(2-fluorophenyl)-2-phenyl-4H-imidazo[1,2-a][1,4]benzodiazepin-8-yl] methyl carbonate?
The canonical SMILES for [6-(2-fluorophenyl)-2-phenyl-4H-imidazo[1,2-a][1,4]benzodiazepin-8-yl] methyl carbonate is COC(=O)Oc1ccc2c(c1)C(c1ccccc1F)=NCc1nc(-c3ccccc3)cn1-2.
What is the InChIKey of [6-(2-fluorophenyl)-2-phenyl-4H-imidazo[1,2-a][1,4]benzodiazepin-8-yl] methyl carbonate?
The InChIKey is KKFRYIOKIQTLFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18FN3O3/c1-31-25(30)32-17-11-12-22-19(13-17)24(18-9-5-6-10-20(18)26)27-14-23-28-21(15-29(22)23)16-7-3-2-4-8-16/h2-13,15H,14H2,1H3.
What are the key properties of [6-(2-fluorophenyl)-2-phenyl-4H-imidazo[1,2-a][1,4]benzodiazepin-8-yl] methyl carbonate?
[6-(2-fluorophenyl)-2-phenyl-4H-imidazo[1,2-a][1,4]benzodiazepin-8-yl] methyl carbonate has a molecular weight of 427.44 g/mol, XLogP of 5.17, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(2-fluorophenyl)-2-phenyl-4H-imidazo[1,2-a][1,4]benzodiazepin-8-yl] methyl carbonate is sourced from PubChem (CID 57062538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).