About 5-bromo-1-[3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)phenyl]pentan-2-one
5-bromo-1-[3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)phenyl]pentan-2-one (PubChem CID 57062708) has the molecular formula C23H37BrO4
and a molecular weight of 457.45 g/mol. Its IUPAC name is 5-bromo-1-[3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)phenyl]pentan-2-one.
Molecular Properties
| Compound Name | 5-bromo-1-[3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)phenyl]pentan-2-one |
| PubChem CID | 57062708 |
| Molecular Formula | C23H37BrO4 |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 5-bromo-1-[3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)phenyl]pentan-2-one |
| SMILES | COCCOCOc1c(C(C)(C)C)cc(CC(=O)CCCBr)cc1C(C)(C)C |
| InChI | InChI=1S/C23H37BrO4/c1-22(2,3)19-14-17(13-18(25)9-8-10-24)15-20(23(4,5)6)21(19)28-16-27-12-11-26-7/h14-15H,8-13,16H2,1-7H3 |
| InChIKey | AZARCIZIJPXLAT-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-1-[3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)phenyl]pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-[3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)phenyl]pentan-2-one?
The IUPAC name of 5-bromo-1-[3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)phenyl]pentan-2-one (CID 57062708) is 5-bromo-1-[3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)phenyl]pentan-2-one.
What is the SMILES notation for 5-bromo-1-[3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)phenyl]pentan-2-one?
The canonical SMILES for 5-bromo-1-[3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)phenyl]pentan-2-one is COCCOCOc1c(C(C)(C)C)cc(CC(=O)CCCBr)cc1C(C)(C)C.
What is the InChIKey of 5-bromo-1-[3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)phenyl]pentan-2-one?
The InChIKey is AZARCIZIJPXLAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H37BrO4/c1-22(2,3)19-14-17(13-18(25)9-8-10-24)15-20(23(4,5)6)21(19)28-16-27-12-11-26-7/h14-15H,8-13,16H2,1-7H3.
What are the key properties of 5-bromo-1-[3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)phenyl]pentan-2-one?
5-bromo-1-[3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)phenyl]pentan-2-one has a molecular weight of 457.45 g/mol, XLogP of 5.57, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-[3,5-ditert-butyl-4-(2-methoxyethoxymethoxy)phenyl]pentan-2-one is sourced from PubChem (CID 57062708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).