C8H8N4O2 — CID 57062800
2,4-dimethyl-5,8-dihydropteridine-6,7-dione (PubChem CID 57062800) has the molecular formula C8H8N4O2 and a molecular weight of 192.18 g/mol. Its IUPAC name is 2,4-dimethyl-5,8-dihydropteridine-6,7-dione.
| Compound Name | 2,4-dimethyl-5,8-dihydropteridine-6,7-dione |
|---|---|
| PubChem CID | 57062800 |
| Molecular Formula | C8H8N4O2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 2,4-dimethyl-5,8-dihydropteridine-6,7-dione |
| SMILES | Cc1nc(C)c2[nH]c(=O)c(=O)[nH]c2n1 |
| InChI | InChI=1S/C8H8N4O2/c1-3-5-6(10-4(2)9-3)12-8(14)7(13)11-5/h1-2H3,(H,11,13)(H,9,10,12,14) |
| InChIKey | IVXOZASLJGEHNW-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|