C31H46O5 — CID 57062841
methyl 5-[(3aS,5R,6S,6aR)-6-[(5R)-5,9-dimethyl-3-oxodeca-1,8-dienyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pent-4-enoate (PubChem CID 57062841) has the molecular formula C31H46O5 and a molecular weight of 498.70 g/mol. Its IUPAC name is methyl 5-[(3aS,5R,6S,6aR)-6-[(5R)-5,9-dimethyl-3-oxodeca-1,8-dienyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pent-4-enoate.
| Compound Name | methyl 5-[(3aS,5R,6S,6aR)-6-[(5R)-5,9-dimethyl-3-oxodeca-1,8-dienyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pent-4-enoate |
|---|---|
| PubChem CID | 57062841 |
| Molecular Formula | C31H46O5 |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 498.33 |
| IUPAC Name | methyl 5-[(3aS,5R,6S,6aR)-6-[(5R)-5,9-dimethyl-3-oxodeca-1,8-dienyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pent-4-enoate |
| SMILES | COC(=O)CCC=CC1=C[C@H]2C[C@@H](OC3CCCCO3)[C@@H](C=CC(=O)C[C@H](C)CCC=C(C)C)[C@@H]2C1 |
| InChI | InChI=1S/C31H46O5/c1-22(2)10-9-11-23(3)18-26(32)15-16-27-28-20-24(12-5-6-13-30(33)34-4)19-25(28)21-29(27)36-31-14-7-8-17-35-31/h5,10,12,15-16,19,23,25,27-29,31H,6-9,11,13-14,17-18,20-21H2,1-4H3/t23-,25+,27+,28-,29-,31?/m1/s1 |
| InChIKey | ZKMKTRTVQQUYOE-HZRRYWLISA-N |
| XLogP | 6.89 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|