C13H11N — CID 57063162
11-azatetracyclo[7.4.1.05,14.010,12]tetradeca-1,3,5(14),6,8-pentaene (PubChem CID 57063162) has the molecular formula C13H11N and a molecular weight of 181.24 g/mol. Its IUPAC name is 11-azatetracyclo[7.4.1.05,14.010,12]tetradeca-1,3,5(14),6,8-pentaene.
| Compound Name | 11-azatetracyclo[7.4.1.05,14.010,12]tetradeca-1,3,5(14),6,8-pentaene |
|---|---|
| PubChem CID | 57063162 |
| Molecular Formula | C13H11N |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 11-azatetracyclo[7.4.1.05,14.010,12]tetradeca-1,3,5(14),6,8-pentaene |
| SMILES | c1cc2c3c(cccc3c1)C1NC1C2 |
| InChI | InChI=1S/C13H11N/c1-3-8-4-2-6-10-12(8)9(5-1)7-11-13(10)14-11/h1-6,11,13-14H,7H2 |
| InChIKey | MLAMLLGGTLVDOW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 21.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|