About 2-acetyl-5,5-dimethylhexanoic acid
2-acetyl-5,5-dimethylhexanoic acid (PubChem CID 57063936) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-acetyl-5,5-dimethylhexanoic acid.
Molecular Properties
| Compound Name | 2-acetyl-5,5-dimethylhexanoic acid |
| PubChem CID | 57063936 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 2-acetyl-5,5-dimethylhexanoic acid |
| SMILES | CC(=O)C(CCC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C10H18O3/c1-7(11)8(9(12)13)5-6-10(2,3)4/h8H,5-6H2,1-4H3,(H,12,13) |
| InChIKey | BWMMQXVILOYIMY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyl-5,5-dimethylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyl-5,5-dimethylhexanoic acid?
The IUPAC name of 2-acetyl-5,5-dimethylhexanoic acid (CID 57063936) is 2-acetyl-5,5-dimethylhexanoic acid.
What is the SMILES notation for 2-acetyl-5,5-dimethylhexanoic acid?
The canonical SMILES for 2-acetyl-5,5-dimethylhexanoic acid is CC(=O)C(CCC(C)(C)C)C(=O)O.
What is the InChIKey of 2-acetyl-5,5-dimethylhexanoic acid?
The InChIKey is BWMMQXVILOYIMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-7(11)8(9(12)13)5-6-10(2,3)4/h8H,5-6H2,1-4H3,(H,12,13).
What are the key properties of 2-acetyl-5,5-dimethylhexanoic acid?
2-acetyl-5,5-dimethylhexanoic acid has a molecular weight of 186.25 g/mol, XLogP of 2.10, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyl-5,5-dimethylhexanoic acid is sourced from PubChem (CID 57063936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).