C27H51O5P — CID 57064141
2-butyl-2-ethyl-1-[trihydroxy-(2,4,6-tritert-butylphenyl)-λ5-phosphanyl]propane-1,3-diol (PubChem CID 57064141) has the molecular formula C27H51O5P and a molecular weight of 486.67 g/mol. Its IUPAC name is 2-butyl-2-ethyl-1-[trihydroxy-(2,4,6-tritert-butylphenyl)-λ5-phosphanyl]propane-1,3-diol.
| Compound Name | 2-butyl-2-ethyl-1-[trihydroxy-(2,4,6-tritert-butylphenyl)-λ5-phosphanyl]propane-1,3-diol |
|---|---|
| PubChem CID | 57064141 |
| Molecular Formula | C27H51O5P |
| Molecular Weight | 486.67 g/mol |
| Exact Mass | 486.35 |
| IUPAC Name | 2-butyl-2-ethyl-1-[trihydroxy-(2,4,6-tritert-butylphenyl)-λ5-phosphanyl]propane-1,3-diol |
| SMILES | CCCCC(CC)(CO)C(O)P(O)(O)(O)c1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C27H51O5P/c1-12-14-15-27(13-2,18-28)23(29)33(30,31,32)22-20(25(6,7)8)16-19(24(3,4)5)17-21(22)26(9,10)11/h16-17,23,28-32H,12-15,18H2,1-11H3 |
| InChIKey | IGVRDZZSSPPTLH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|