About (1-propylcyclohexyl) 1-(3,4-difluorophenyl)cyclohexane-1-carboxylate
(1-propylcyclohexyl) 1-(3,4-difluorophenyl)cyclohexane-1-carboxylate (PubChem CID 57064144) has the molecular formula C22H30F2O2
and a molecular weight of 364.48 g/mol. Its IUPAC name is (1-propylcyclohexyl) 1-(3,4-difluorophenyl)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (1-propylcyclohexyl) 1-(3,4-difluorophenyl)cyclohexane-1-carboxylate |
| PubChem CID | 57064144 |
| Molecular Formula | C22H30F2O2 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (1-propylcyclohexyl) 1-(3,4-difluorophenyl)cyclohexane-1-carboxylate |
| SMILES | CCCC1(OC(=O)C2(c3ccc(F)c(F)c3)CCCCC2)CCCCC1 |
| InChI | InChI=1S/C22H30F2O2/c1-2-11-21(12-5-3-6-13-21)26-20(25)22(14-7-4-8-15-22)17-9-10-18(23)19(24)16-17/h9-10,16H,2-8,11-15H2,1H3 |
| InChIKey | XQMMTFGEIZTHPQ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-propylcyclohexyl) 1-(3,4-difluorophenyl)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-propylcyclohexyl) 1-(3,4-difluorophenyl)cyclohexane-1-carboxylate?
The IUPAC name of (1-propylcyclohexyl) 1-(3,4-difluorophenyl)cyclohexane-1-carboxylate (CID 57064144) is (1-propylcyclohexyl) 1-(3,4-difluorophenyl)cyclohexane-1-carboxylate.
What is the SMILES notation for (1-propylcyclohexyl) 1-(3,4-difluorophenyl)cyclohexane-1-carboxylate?
The canonical SMILES for (1-propylcyclohexyl) 1-(3,4-difluorophenyl)cyclohexane-1-carboxylate is CCCC1(OC(=O)C2(c3ccc(F)c(F)c3)CCCCC2)CCCCC1.
What is the InChIKey of (1-propylcyclohexyl) 1-(3,4-difluorophenyl)cyclohexane-1-carboxylate?
The InChIKey is XQMMTFGEIZTHPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30F2O2/c1-2-11-21(12-5-3-6-13-21)26-20(25)22(14-7-4-8-15-22)17-9-10-18(23)19(24)16-17/h9-10,16H,2-8,11-15H2,1H3.
What are the key properties of (1-propylcyclohexyl) 1-(3,4-difluorophenyl)cyclohexane-1-carboxylate?
(1-propylcyclohexyl) 1-(3,4-difluorophenyl)cyclohexane-1-carboxylate has a molecular weight of 364.48 g/mol, XLogP of 6.21, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-propylcyclohexyl) 1-(3,4-difluorophenyl)cyclohexane-1-carboxylate is sourced from PubChem (CID 57064144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).